C21H21FN3O6P — CID 171568504
2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde (PubChem CID 171568504) has the molecular formula C21H21FN3O6P and a molecular weight of 461.39 g/mol. Its IUPAC name is 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde.
| Compound Name | 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde |
|---|---|
| PubChem CID | 171568504 |
| Molecular Formula | C21H21FN3O6P |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde |
| SMILES | O=CCNP(OCC1CC(F)C(n2ccc(=O)[nH]c2=O)O1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H21FN3O6P/c22-18-12-17(30-20(18)25-9-7-19(27)24-21(25)28)13-29-32(23-8-10-26)31-16-6-5-14-3-1-2-4-15(14)11-16/h1-7,9-11,17-18,20,23H,8,12-13H2,(H,24,27,28) |
| InChIKey | ZHAWGWUTODEWEK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|