C10H13FN2O5 — CID 144766802
1-[3-fluoro-5-(methylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 144766802) has the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-[3-fluoro-5-(methylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-fluoro-5-(methylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144766802 |
| Molecular Formula | C10H13FN2O5 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-[3-fluoro-5-(methylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COOCC1CC(F)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H13FN2O5/c1-16-17-5-6-4-7(11)9(18-6)13-3-2-8(14)12-10(13)15/h2-3,6-7,9H,4-5H2,1H3,(H,12,14,15) |
| InChIKey | BXEXKOFOZIDJFE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|