C13H23IN2O4S — CID 144654228
[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy thiohypoiodite;ethane;methane (PubChem CID 144654228) has the molecular formula C13H23IN2O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy thiohypoiodite;ethane;methane.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy thiohypoiodite;ethane;methane |
|---|---|
| PubChem CID | 144654228 |
| Molecular Formula | C13H23IN2O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy thiohypoiodite;ethane;methane |
| SMILES | C.CC.CC1CC(COSI)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13IN2O4S.C2H6.CH4/c1-6-4-7(5-16-18-11)17-9(6)13-3-2-8(14)12-10(13)15;1-2;/h2-3,6-7,9H,4-5H2,1H3,(H,12,14,15);1-2H3;1H4 |
| InChIKey | JAVPXKVGLJBCHU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|