C22H29N2O9P — CID 142622656
[(1R)-1-(1,3-dioxolan-2-yl)propyl] [(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl phenyl phosphate (PubChem CID 142622656) has the molecular formula C22H29N2O9P and a molecular weight of 496.45 g/mol. Its IUPAC name is [(1R)-1-(1,3-dioxolan-2-yl)propyl] [(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl phenyl phosphate.
| Compound Name | [(1R)-1-(1,3-dioxolan-2-yl)propyl] [(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl phenyl phosphate |
|---|---|
| PubChem CID | 142622656 |
| Molecular Formula | C22H29N2O9P |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [(1R)-1-(1,3-dioxolan-2-yl)propyl] [(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl phenyl phosphate |
| SMILES | CC[C@@H](OP(=O)(OC[C@@H]1C[C@H](C)[C@H](n2ccc(=O)[nH]c2=O)O1)Oc1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C22H29N2O9P/c1-3-18(21-28-11-12-29-21)33-34(27,32-16-7-5-4-6-8-16)30-14-17-13-15(2)20(31-17)24-10-9-19(25)23-22(24)26/h4-10,15,17-18,20-21H,3,11-14H2,1-2H3,(H,23,25,26)/t15-,17-,18+,20+,34?/m0/s1 |
| InChIKey | YUPNKDWXXRWQTK-VKFZJWRXSA-N |
| XLogP | 2.83 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|