C23H31ClN3O8P — CID 138736012
butyl (2S)-2-[[(2-chlorophenoxy)-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 138736012) has the molecular formula C23H31ClN3O8P and a molecular weight of 543.94 g/mol. Its IUPAC name is butyl (2S)-2-[[(2-chlorophenoxy)-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[(2-chlorophenoxy)-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138736012 |
| Molecular Formula | C23H31ClN3O8P |
| Molecular Weight | 543.94 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | butyl (2S)-2-[[(2-chlorophenoxy)-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OCC1CC(C)C(n2ccc(=O)[nH]c2=O)O1)Oc1ccccc1Cl |
| InChI | InChI=1S/C23H31ClN3O8P/c1-4-5-12-32-22(29)16(3)26-36(31,35-19-9-7-6-8-18(19)24)33-14-17-13-15(2)21(34-17)27-11-10-20(28)25-23(27)30/h6-11,15-17,21H,4-5,12-14H2,1-3H3,(H,26,31)(H,25,28,30)/t15?,16-,17?,21?,36?/m0/s1 |
| InChIKey | WRDDELWXAPKUED-IBXMJTFNSA-N |
| XLogP | 3.64 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|