C21H33N3O9PS+ — CID 123789588
2-[2,2-dimethyl-3-(propan-2-yloxycarbonylamino)propanoyl]sulfanylethoxy-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]-oxophosphanium (PubChem CID 123789588) has the molecular formula C21H33N3O9PS+ and a molecular weight of 534.55 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-(propan-2-yloxycarbonylamino)propanoyl]sulfanylethoxy-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]-oxophosphanium.
| Compound Name | 2-[2,2-dimethyl-3-(propan-2-yloxycarbonylamino)propanoyl]sulfanylethoxy-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 123789588 |
| Molecular Formula | C21H33N3O9PS+ |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[2,2-dimethyl-3-(propan-2-yloxycarbonylamino)propanoyl]sulfanylethoxy-[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
| SMILES | CC(C)OC(=O)NCC(C)(C)C(=O)SCCO[P+](=O)OCC1CC(C)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C21H32N3O9PS/c1-13(2)32-20(28)22-12-21(4,5)18(26)35-9-8-30-34(29)31-11-15-10-14(3)17(33-15)24-7-6-16(25)23-19(24)27/h6-7,13-15,17H,8-12H2,1-5H3,(H-,22,23,25,27,28)/p+1 |
| InChIKey | LAWQHKIGSWRWGP-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|