C17H26N2O9PS+ — CID 123412170
[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-methyloxolan-2-yl]methoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium (PubChem CID 123412170) has the molecular formula C17H26N2O9PS+ and a molecular weight of 465.44 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-methyloxolan-2-yl]methoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-methyloxolan-2-yl]methoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 123412170 |
| Molecular Formula | C17H26N2O9PS+ |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-methyloxolan-2-yl]methoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium |
| SMILES | CC1C(CO[P+](=O)OCCSC(=O)C(C)(C)CO)OC(n2ccc(=O)[nH]c2=O)C1O |
| InChI | InChI=1S/C17H25N2O9PS/c1-10-11(28-14(13(10)22)19-5-4-12(21)18-16(19)24)8-27-29(25)26-6-7-30-15(23)17(2,3)9-20/h4-5,10-11,13-14,20,22H,6-9H2,1-3H3/p+1 |
| InChIKey | DFRKDARPPWUUHQ-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|