C22H32F3N4O6P — CID 144900390
2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetaldehyde;difluoromethane;2-methoxypropane (PubChem CID 144900390) has the molecular formula C22H32F3N4O6P and a molecular weight of 536.49 g/mol. Its IUPAC name is 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetaldehyde;difluoromethane;2-methoxypropane.
| Compound Name | 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetaldehyde;difluoromethane;2-methoxypropane |
|---|---|
| PubChem CID | 144900390 |
| Molecular Formula | C22H32F3N4O6P |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetaldehyde;difluoromethane;2-methoxypropane |
| SMILES | COC(C)C.FCF.Nc1ccn(C2OC(COP(NCC=O)Oc3ccccc3)CC2F)c(=O)n1 |
| InChI | InChI=1S/C17H20FN4O5P.C4H10O.CH2F2/c18-14-10-13(26-16(14)22-8-6-15(19)21-17(22)24)11-25-28(20-7-9-23)27-12-4-2-1-3-5-12;1-4(2)5-3;2-1-3/h1-6,8-9,13-14,16,20H,7,10-11H2,(H2,19,21,24);4H,1-3H3;1H2 |
| InChIKey | LMFZGHVKGKKXPN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|