C12H20N3O7P — CID 171568409
[5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 171568409) has the molecular formula C12H20N3O7P and a molecular weight of 349.28 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 171568409 |
| Molecular Formula | C12H20N3O7P |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCC1CC(O)C(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C12H20N3O7P/c1-7(2)22-23(18,19)20-6-8-5-9(16)11(21-8)15-4-3-10(13)14-12(15)17/h3-4,7-9,11,16H,5-6H2,1-2H3,(H,18,19)(H2,13,14,17) |
| InChIKey | SXJZBBAMDFAXBD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|