C23H38N3O9PS2 — CID 5274663
S-[2-[[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 5274663) has the molecular formula C23H38N3O9PS2 and a molecular weight of 595.68 g/mol. Its IUPAC name is S-[2-[[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 5274663 |
| Molecular Formula | C23H38N3O9PS2 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | S-[2-[[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@@H]1C[C@@H](O)[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C23H38N3O9PS2/c1-22(2,3)19(28)37-11-9-32-36(31,33-10-12-38-20(29)23(4,5)6)34-14-15-13-16(27)18(35-15)26-8-7-17(24)25-21(26)30/h7-8,15-16,18,27H,9-14H2,1-6H3,(H2,24,25,30)/t15-,16+,18+/m0/s1 |
| InChIKey | QJSSSPMWZYWGLQ-LZLYRXPVSA-N |
| XLogP | 3.24 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|