C30H49N3O7S4 — CID 165408929
S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]thiolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate (PubChem CID 165408929) has the molecular formula C30H49N3O7S4 and a molecular weight of 692.00 g/mol. Its IUPAC name is S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]thiolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]thiolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 165408929 |
| Molecular Formula | C30H49N3O7S4 |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]thiolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOC[C@H]1S[C@@H](n2ccc(N)nc2=O)C(OCCSC(=O)C(C)(C)C)C1OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H49N3O7S4/c1-28(2,3)24(34)41-15-12-38-18-19-21(39-13-16-42-25(35)29(4,5)6)22(40-14-17-43-26(36)30(7,8)9)23(44-19)33-11-10-20(31)32-27(33)37/h10-11,19,21-23H,12-18H2,1-9H3,(H2,31,32,37)/t19-,21?,22?,23-/m1/s1 |
| InChIKey | KAMWLIXAJNKCTK-SDXIKQIGSA-N |
| XLogP | 5.14 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|