C30H49N3O9S3 — CID 155606850
S-[2-[[(2R,3R,4R,5R)-5-deuterio-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate (PubChem CID 155606850) has the molecular formula C30H49N3O9S3 and a molecular weight of 692.94 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-deuterio-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-deuterio-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 155606850 |
| Molecular Formula | C30H49N3O9S3 |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-deuterio-3,4-bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy]ethyl] 2,2-dimethylpropanethioate |
| SMILES | [2H][C@@]1(n2ccc(NO)nc2=O)O[C@H](COCCSC(=O)C(C)(C)C)[C@@H](OCCSC(=O)C(C)(C)C)[C@H]1OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H49N3O9S3/c1-28(2,3)24(34)43-15-12-39-18-19-21(40-13-16-44-25(35)29(4,5)6)22(41-14-17-45-26(36)30(7,8)9)23(42-19)33-11-10-20(32-38)31-27(33)37/h10-11,19,21-23,38H,12-18H2,1-9H3,(H,31,32,37)/t19-,21-,22-,23-/m1/s1/i23D |
| InChIKey | XCCPIZJSNXBRSB-WWOLGOAQSA-N |
| XLogP | 4.65 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|