C21H25N3O9 — CID 155606839
[(2R,3R,4R,5R)-3,4-bis(cyclopropanecarbonyloxy)-5-deuterio-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl cyclopropanecarboxylate (PubChem CID 155606839) has the molecular formula C21H25N3O9 and a molecular weight of 464.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis(cyclopropanecarbonyloxy)-5-deuterio-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl cyclopropanecarboxylate.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis(cyclopropanecarbonyloxy)-5-deuterio-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 155606839 |
| Molecular Formula | C21H25N3O9 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis(cyclopropanecarbonyloxy)-5-deuterio-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl cyclopropanecarboxylate |
| SMILES | [2H][C@@]1(n2ccc(NO)nc2=O)O[C@H](COC(=O)C2CC2)[C@@H](OC(=O)C2CC2)[C@H]1OC(=O)C1CC1 |
| InChI | InChI=1S/C21H25N3O9/c25-18(10-1-2-10)30-9-13-15(32-19(26)11-3-4-11)16(33-20(27)12-5-6-12)17(31-13)24-8-7-14(23-29)22-21(24)28/h7-8,10-13,15-17,29H,1-6,9H2,(H,22,23,28)/t13-,15-,16-,17-/m1/s1/i17D |
| InChIKey | ZDOQUGHKOUUTAQ-NEYIBDGNSA-N |
| XLogP | 0.54 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|