C30H25N3O7S — CID 175034857
[(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate (PubChem CID 175034857) has the molecular formula C30H25N3O7S and a molecular weight of 571.61 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 175034857 |
| Molecular Formula | C30H25N3O7S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate |
| SMILES | Nc1ccn(C2S[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C30H25N3O7S/c31-23-16-17-33(30(37)32-23)26-25(40-29(36)21-14-8-3-9-15-21)24(39-28(35)20-12-6-2-7-13-20)22(41-26)18-38-27(34)19-10-4-1-5-11-19/h1-17,22,24-26H,18H2,(H2,31,32,37)/t22-,24-,25-,26?/m1/s1 |
| InChIKey | GLBGOZCLYQPXBR-HLGCDXFVSA-N |
| XLogP | 3.75 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|