C23H21FN3O8PS — CID 121315044
[(2R,3S,4S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(phosphonooxymethyl)thiolan-3-yl] benzoate (PubChem CID 121315044) has the molecular formula C23H21FN3O8PS and a molecular weight of 549.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(phosphonooxymethyl)thiolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(phosphonooxymethyl)thiolan-3-yl] benzoate |
|---|---|
| PubChem CID | 121315044 |
| Molecular Formula | C23H21FN3O8PS |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(phosphonooxymethyl)thiolan-3-yl] benzoate |
| SMILES | O=C(Nc1ccn([C@@H]2S[C@H](COP(=O)(O)O)[C@@H](OC(=O)c3ccccc3)[C@@H]2F)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C23H21FN3O8PS/c24-18-19(35-22(29)15-9-5-2-6-10-15)16(13-34-36(31,32)33)37-21(18)27-12-11-17(26-23(27)30)25-20(28)14-7-3-1-4-8-14/h1-12,16,18-19,21H,13H2,(H2,31,32,33)(H,25,26,28,30)/t16-,18+,19-,21-/m1/s1 |
| InChIKey | BPETVUVOWNMMLE-WQZMEWCLSA-N |
| XLogP | 2.78 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|