C23H22FN3O5S — CID 145072918
benzoic acid;N-[1-[3-fluoro-5-(hydroxymethyl)thiolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 145072918) has the molecular formula C23H22FN3O5S and a molecular weight of 471.51 g/mol. Its IUPAC name is benzoic acid;N-[1-[3-fluoro-5-(hydroxymethyl)thiolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | benzoic acid;N-[1-[3-fluoro-5-(hydroxymethyl)thiolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 145072918 |
| Molecular Formula | C23H22FN3O5S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | benzoic acid;N-[1-[3-fluoro-5-(hydroxymethyl)thiolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | O=C(Nc1ccn(C2SC(CO)CC2F)c(=O)n1)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C16H16FN3O3S.C7H6O2/c17-12-8-11(9-21)24-15(12)20-7-6-13(19-16(20)23)18-14(22)10-4-2-1-3-5-10;8-7(9)6-4-2-1-3-5-6/h1-7,11-12,15,21H,8-9H2,(H,18,19,22,23);1-5H,(H,8,9) |
| InChIKey | HSLGTMRWJRCHMV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |