C23H20FN3O5S — CID 130297988
[5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)thiolan-3-yl] benzoate (PubChem CID 130297988) has the molecular formula C23H20FN3O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)thiolan-3-yl] benzoate.
| Compound Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)thiolan-3-yl] benzoate |
|---|---|
| PubChem CID | 130297988 |
| Molecular Formula | C23H20FN3O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(hydroxymethyl)thiolan-3-yl] benzoate |
| SMILES | O=C(Nc1ccn(C2SC(CO)C(OC(=O)c3ccccc3)C2F)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C23H20FN3O5S/c24-18-19(32-22(30)15-9-5-2-6-10-15)16(13-28)33-21(18)27-12-11-17(26-23(27)31)25-20(29)14-7-3-1-4-8-14/h1-12,16,18-19,21,28H,13H2,(H,25,26,29,31) |
| InChIKey | KYBXCLBWKSVGCK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |