C22H19N3O5S — CID 131730078
[(2S)-4-(4-benzamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate (PubChem CID 131730078) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is [(2S)-4-(4-benzamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate.
| Compound Name | [(2S)-4-(4-benzamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 131730078 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | [(2S)-4-(4-benzamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate |
| SMILES | O=C(Nc1ccn(C2CO[C@H](COC(=O)c3ccccc3)S2)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O5S/c26-20(15-7-3-1-4-8-15)23-17-11-12-25(22(28)24-17)18-13-29-19(31-18)14-30-21(27)16-9-5-2-6-10-16/h1-12,18-19H,13-14H2,(H,23,24,26,28)/t18?,19-/m0/s1 |
| InChIKey | XQBRZRVPNRAYOW-GGYWPGCISA-N |
| XLogP | 2.94 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |