C42H34FN3O6 — CID 140549413
[5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate (PubChem CID 140549413) has the molecular formula C42H34FN3O6 and a molecular weight of 695.75 g/mol. Its IUPAC name is [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 140549413 |
| Molecular Formula | C42H34FN3O6 |
| Molecular Weight | 695.75 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(Nc1ccn(C2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(OC(=O)c3ccccc3)C2F)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C42H34FN3O6/c43-36-37(52-40(48)30-18-8-2-9-19-30)34(51-39(36)46-27-26-35(45-41(46)49)44-38(47)29-16-6-1-7-17-29)28-50-42(31-20-10-3-11-21-31,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-27,34,36-37,39H,28H2,(H,44,45,47,49) |
| InChIKey | CTMRJUSNQCRHNP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|