C28H48FN4O10P — CID 123687371
[2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-[(2-butyl-3-methyloctyl)amino]propanoate (PubChem CID 123687371) has the molecular formula C28H48FN4O10P and a molecular weight of 650.68 g/mol. Its IUPAC name is [2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-[(2-butyl-3-methyloctyl)amino]propanoate.
| Compound Name | [2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-[(2-butyl-3-methyloctyl)amino]propanoate |
|---|---|
| PubChem CID | 123687371 |
| Molecular Formula | C28H48FN4O10P |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | [2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-[(2-butyl-3-methyloctyl)amino]propanoate |
| SMILES | CCCCCC(C)C(CCCC)CNCCC(=O)OCC(=O)OCOP(=O)(O)OCC1CC(F)C(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C28H48FN4O10P/c1-4-6-8-9-20(3)21(10-7-5-2)16-31-13-11-25(34)39-18-26(35)40-19-42-44(37,38)41-17-22-15-23(29)27(43-22)33-14-12-24(30)32-28(33)36/h12,14,20-23,27,31H,4-11,13,15-19H2,1-3H3,(H,37,38)(H2,30,32,36) |
| InChIKey | YBHGDPFQKUEJAB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 190.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|