C18H28FN4O10P — CID 146366512
[2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-(propylamino)propanoate (PubChem CID 146366512) has the molecular formula C18H28FN4O10P and a molecular weight of 510.41 g/mol. Its IUPAC name is [2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-(propylamino)propanoate.
| Compound Name | [2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-(propylamino)propanoate |
|---|---|
| PubChem CID | 146366512 |
| Molecular Formula | C18H28FN4O10P |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl]oxymethoxy]-2-oxoethyl] 3-(propylamino)propanoate |
| SMILES | CCCNCCC(=O)OCC(=O)OCOP(=O)(O)OC[C@@H]1C[C@H](F)[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C18H28FN4O10P/c1-2-5-21-6-3-15(24)29-10-16(25)30-11-32-34(27,28)31-9-12-8-13(19)17(33-12)23-7-4-14(20)22-18(23)26/h4,7,12-13,17,21H,2-3,5-6,8-11H2,1H3,(H,27,28)(H2,20,22,26)/t12-,13-,17+/m0/s1 |
| InChIKey | MQQKPJJIZLMGKW-GDZNZVCISA-N |
| XLogP | 0.02 |
| TPSA | 190.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|