C20H25F2N4O7P — CID 142319611
ethyl (2S)-2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 142319611) has the molecular formula C20H25F2N4O7P and a molecular weight of 502.41 g/mol. Its IUPAC name is ethyl (2S)-2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 142319611 |
| Molecular Formula | C20H25F2N4O7P |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl (2S)-2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OCC1CC(F)(F)C(n2ccc(N)nc2=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C20H25F2N4O7P/c1-3-30-17(27)13(2)25-34(29,33-14-7-5-4-6-8-14)31-12-15-11-20(21,22)18(32-15)26-10-9-16(23)24-19(26)28/h4-10,13,15,18H,3,11-12H2,1-2H3,(H,25,29)(H2,23,24,28)/t13-,15?,18?,34?/m0/s1 |
| InChIKey | IKAVXWDJEGSGKY-OBNAXEGPSA-N |
| XLogP | 2.49 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|