C19H26N3O7P — CID 86333380
N-[1-[(2R)-2-(diethoxyphosphorylmethoxy)-3-hydroxypropyl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 86333380) has the molecular formula C19H26N3O7P and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[1-[(2R)-2-(diethoxyphosphorylmethoxy)-3-hydroxypropyl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R)-2-(diethoxyphosphorylmethoxy)-3-hydroxypropyl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 86333380 |
| Molecular Formula | C19H26N3O7P |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[1-[(2R)-2-(diethoxyphosphorylmethoxy)-3-hydroxypropyl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CCOP(=O)(CO[C@@H](CO)Cn1ccc(NC(=O)c2ccccc2)nc1=O)OCC |
| InChI | InChI=1S/C19H26N3O7P/c1-3-28-30(26,29-4-2)14-27-16(13-23)12-22-11-10-17(21-19(22)25)20-18(24)15-8-6-5-7-9-15/h5-11,16,23H,3-4,12-14H2,1-2H3,(H,20,21,24,25)/t16-/m1/s1 |
| InChIKey | WYJNVSZEUBNGND-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|