C29H42N3O8P — CID 144706649
4-amino-1-[2-[[(3-butoxy-2-phenylmethoxypropoxy)-(cyclohexa-1,5-dien-1-ylmethoxy)phosphoryl]methoxy]-3-hydroxypropyl]pyrimidin-2-one (PubChem CID 144706649) has the molecular formula C29H42N3O8P and a molecular weight of 591.64 g/mol. Its IUPAC name is 4-amino-1-[2-[[(3-butoxy-2-phenylmethoxypropoxy)-(cyclohexa-1,5-dien-1-ylmethoxy)phosphoryl]methoxy]-3-hydroxypropyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[2-[[(3-butoxy-2-phenylmethoxypropoxy)-(cyclohexa-1,5-dien-1-ylmethoxy)phosphoryl]methoxy]-3-hydroxypropyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 144706649 |
| Molecular Formula | C29H42N3O8P |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 4-amino-1-[2-[[(3-butoxy-2-phenylmethoxypropoxy)-(cyclohexa-1,5-dien-1-ylmethoxy)phosphoryl]methoxy]-3-hydroxypropyl]pyrimidin-2-one |
| SMILES | CCCCOCC(COP(=O)(COC(CO)Cn1ccc(N)nc1=O)OCC1=CCCC=C1)OCc1ccccc1 |
| InChI | InChI=1S/C29H42N3O8P/c1-2-3-16-36-21-27(37-19-24-10-6-4-7-11-24)22-40-41(35,39-20-25-12-8-5-9-13-25)23-38-26(18-33)17-32-15-14-28(30)31-29(32)34/h4,6-8,10-15,26-27,33H,2-3,5,9,16-23H2,1H3,(H2,30,31,34) |
| InChIKey | YIOKDXRURSTWEL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|