C19H21N3O6 — CID 101233783
diethyl 2-[(4-benzamido-2-oxopyrimidin-1-yl)methyl]propanedioate (PubChem CID 101233783) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is diethyl 2-[(4-benzamido-2-oxopyrimidin-1-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(4-benzamido-2-oxopyrimidin-1-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 101233783 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | diethyl 2-[(4-benzamido-2-oxopyrimidin-1-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cn1ccc(NC(=O)c2ccccc2)nc1=O)C(=O)OCC |
| InChI | InChI=1S/C19H21N3O6/c1-3-27-17(24)14(18(25)28-4-2)12-22-11-10-15(21-19(22)26)20-16(23)13-8-6-5-7-9-13/h5-11,14H,3-4,12H2,1-2H3,(H,20,21,23,26) |
| InChIKey | MVKSNJLUVNCASJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|