C24H25N3O5 — CID 118012119
[(2R)-2-[(2S)-2-(4-benzamido-2-oxopyrimidin-1-yl)propoxy]propyl] benzoate (PubChem CID 118012119) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is [(2R)-2-[(2S)-2-(4-benzamido-2-oxopyrimidin-1-yl)propoxy]propyl] benzoate.
| Compound Name | [(2R)-2-[(2S)-2-(4-benzamido-2-oxopyrimidin-1-yl)propoxy]propyl] benzoate |
|---|---|
| PubChem CID | 118012119 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [(2R)-2-[(2S)-2-(4-benzamido-2-oxopyrimidin-1-yl)propoxy]propyl] benzoate |
| SMILES | C[C@H](COC(=O)c1ccccc1)OC[C@H](C)n1ccc(NC(=O)c2ccccc2)nc1=O |
| InChI | InChI=1S/C24H25N3O5/c1-17(15-31-18(2)16-32-23(29)20-11-7-4-8-12-20)27-14-13-21(26-24(27)30)25-22(28)19-9-5-3-6-10-19/h3-14,17-18H,15-16H2,1-2H3,(H,25,26,28,30)/t17-,18+/m0/s1 |
| InChIKey | XJNFPTKAAYZXFB-ZWKOTPCHSA-N |
| XLogP | 3.32 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |