C18H23NO9 — CID 122436253
4-O-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-(3-oxopiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122436253) has the molecular formula C18H23NO9 and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-O-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-(3-oxopiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-(3-oxopiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436253 |
| Molecular Formula | C18H23NO9 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-O-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-(3-oxopiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(CN1CCCC(=O)C1)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C18H23NO9/c1-25-15(21)5-7-17(23)27-12-14(11-19-9-3-4-13(20)10-19)28-18(24)8-6-16(22)26-2/h5-8,14H,3-4,9-12H2,1-2H3/b7-5+,8-6+ |
| InChIKey | HBJGHNKACLRQFP-KQQUZDAGSA-N |
| XLogP | -0.44 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|