C32H51N3O10 — CID 122436307
4-O-[2-[(E)-4-(4-morpholin-4-ylbutoxy)-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] 1-O-(4-morpholin-4-ylbutyl) (E)-but-2-enedioate (PubChem CID 122436307) has the molecular formula C32H51N3O10 and a molecular weight of 637.77 g/mol. Its IUPAC name is 4-O-[2-[(E)-4-(4-morpholin-4-ylbutoxy)-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] 1-O-(4-morpholin-4-ylbutyl) (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[(E)-4-(4-morpholin-4-ylbutoxy)-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] 1-O-(4-morpholin-4-ylbutyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436307 |
| Molecular Formula | C32H51N3O10 |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | 4-O-[2-[(E)-4-(4-morpholin-4-ylbutoxy)-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] 1-O-(4-morpholin-4-ylbutyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCC(CN1CCCCC1)OC(=O)/C=C/C(=O)OCCCCN1CCOCC1)OCCCCN1CCOCC1 |
| InChI | InChI=1S/C32H51N3O10/c36-29(42-20-6-4-12-33-16-22-40-23-17-33)8-9-31(38)44-27-28(26-35-14-2-1-3-15-35)45-32(39)11-10-30(37)43-21-7-5-13-34-18-24-41-25-19-34/h8-11,28H,1-7,12-27H2/b9-8+,11-10+ |
| InChIKey | UMVNAWDBWVZACX-BNFZFUHLSA-N |
| XLogP | 1.35 |
| TPSA | 133.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|