C16H25NO8 — CID 122667401
4-O-[2-hydroxy-3-(4-morpholin-4-ylbutoxy)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122667401) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-O-[2-hydroxy-3-(4-morpholin-4-ylbutoxy)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-hydroxy-3-(4-morpholin-4-ylbutoxy)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122667401 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-O-[2-hydroxy-3-(4-morpholin-4-ylbutoxy)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(O)C(=O)OCCCCN1CCOCC1 |
| InChI | InChI=1S/C16H25NO8/c1-22-14(19)4-5-15(20)25-12-13(18)16(21)24-9-3-2-6-17-7-10-23-11-8-17/h4-5,13,18H,2-3,6-12H2,1H3/b5-4+ |
| InChIKey | VMTBRHJIHVOPPT-SNAWJCMRSA-N |
| XLogP | -0.72 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|