C17H23NO9 — CID 122436425
4-O-[(2S)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-morpholin-4-ylpropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122436425) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is 4-O-[(2S)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-morpholin-4-ylpropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2S)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-morpholin-4-ylpropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436425 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-O-[(2S)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3-morpholin-4-ylpropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC[C@H](CN1CCOCC1)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C17H23NO9/c1-23-14(19)3-5-16(21)26-12-13(11-18-7-9-25-10-8-18)27-17(22)6-4-15(20)24-2/h3-6,13H,7-12H2,1-2H3/b5-3+,6-4+/t13-/m0/s1 |
| InChIKey | ZVHXSHGTXCBTJG-XNCQCXSQSA-N |
| XLogP | -0.77 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|