C15H24ClNO8 — CID 157079656
2,3-bis[[(E)-4-methoxy-4-oxobut-2-enoyl]oxy]propyl-dimethylazanium;molecular hydrogen;chloride (PubChem CID 157079656) has the molecular formula C15H24ClNO8 and a molecular weight of 381.81 g/mol. Its IUPAC name is 2,3-bis[[(E)-4-methoxy-4-oxobut-2-enoyl]oxy]propyl-dimethylazanium;molecular hydrogen;chloride.
| Compound Name | 2,3-bis[[(E)-4-methoxy-4-oxobut-2-enoyl]oxy]propyl-dimethylazanium;molecular hydrogen;chloride |
|---|---|
| PubChem CID | 157079656 |
| Molecular Formula | C15H24ClNO8 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2,3-bis[[(E)-4-methoxy-4-oxobut-2-enoyl]oxy]propyl-dimethylazanium;molecular hydrogen;chloride |
| SMILES | COC(=O)/C=C/C(=O)OCC(C[NH+](C)C)OC(=O)/C=C/C(=O)OC.[Cl-].[H][H] |
| InChI | InChI=1S/C15H21NO8.ClH.H2/c1-16(2)9-11(24-15(20)8-6-13(18)22-4)10-23-14(19)7-5-12(17)21-3;;/h5-8,11H,9-10H2,1-4H3;2*1H/b7-5+,8-6+;; |
| InChIKey | ZCTYSVZLGXCGFF-ZHINHYBUSA-N |
| XLogP | -4.71 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|