C21H21NO8 — CID 140732391
4-O-[3-indol-1-yl-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 140732391) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is 4-O-[3-indol-1-yl-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-indol-1-yl-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 140732391 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-O-[3-indol-1-yl-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(Cn1ccc2ccccc21)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C21H21NO8/c1-27-18(23)7-9-20(25)29-14-16(30-21(26)10-8-19(24)28-2)13-22-12-11-15-5-3-4-6-17(15)22/h3-12,16H,13-14H2,1-2H3/b9-7+,10-8+ |
| InChIKey | FYKYAGPPBVIXJD-FIFLTTCUSA-N |
| XLogP | 1.55 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|