C15H19N3O8 — CID 140732384
4-O-[3-(4,5-dihydrotriazol-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 140732384) has the molecular formula C15H19N3O8 and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-O-[3-(4,5-dihydrotriazol-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-(4,5-dihydrotriazol-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 140732384 |
| Molecular Formula | C15H19N3O8 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-O-[3-(4,5-dihydrotriazol-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(CN1CCN=N1)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C15H19N3O8/c1-23-12(19)3-5-14(21)25-10-11(9-18-8-7-16-17-18)26-15(22)6-4-13(20)24-2/h3-6,11H,7-10H2,1-2H3/b5-3+,6-4+ |
| InChIKey | MODSCFURTHGBQK-GGWOSOGESA-N |
| XLogP | -0.42 |
| TPSA | 133.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|