C24H37NO8 — CID 122436301
4-O-tert-butyl 1-O-[2-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] (E)-but-2-enedioate (PubChem CID 122436301) has the molecular formula C24H37NO8 and a molecular weight of 467.56 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[2-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] (E)-but-2-enedioate.
| Compound Name | 4-O-tert-butyl 1-O-[2-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436301 |
| Molecular Formula | C24H37NO8 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-O-tert-butyl 1-O-[2-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]oxy-3-piperidin-1-ylpropyl] (E)-but-2-enedioate |
| SMILES | CC(C)(C)OC(=O)/C=C/C(=O)OCC(CN1CCCCC1)OC(=O)/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37NO8/c1-23(2,3)32-21(28)12-10-19(26)30-17-18(16-25-14-8-7-9-15-25)31-20(27)11-13-22(29)33-24(4,5)6/h10-13,18H,7-9,14-17H2,1-6H3/b12-10+,13-11+ |
| InChIKey | SKOHXORBARTMEN-DCIPZJNNSA-N |
| XLogP | 2.72 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|