C12H15Br6NO4 — CID 162509399
[3-piperidin-1-yl-2-(2,2,2-tribromoacetyl)oxypropyl] 2,2,2-tribromoacetate (PubChem CID 162509399) has the molecular formula C12H15Br6NO4 and a molecular weight of 716.68 g/mol. Its IUPAC name is [3-piperidin-1-yl-2-(2,2,2-tribromoacetyl)oxypropyl] 2,2,2-tribromoacetate.
| Compound Name | [3-piperidin-1-yl-2-(2,2,2-tribromoacetyl)oxypropyl] 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 162509399 |
| Molecular Formula | C12H15Br6NO4 |
| Molecular Weight | 716.68 g/mol |
| Exact Mass | 710.61 |
| IUPAC Name | [3-piperidin-1-yl-2-(2,2,2-tribromoacetyl)oxypropyl] 2,2,2-tribromoacetate |
| SMILES | O=C(OCC(CN1CCCCC1)OC(=O)C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | InChI=1S/C12H15Br6NO4/c13-11(14,15)9(20)22-7-8(23-10(21)12(16,17)18)6-19-4-2-1-3-5-19/h8H,1-7H2 |
| InChIKey | WPKSREACAHVGCZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|