C14H27NO2 — CID 117242052
methyl 4,4-dimethyl-2-(piperidin-1-ylmethyl)pentanoate (PubChem CID 117242052) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is methyl 4,4-dimethyl-2-(piperidin-1-ylmethyl)pentanoate.
| Compound Name | methyl 4,4-dimethyl-2-(piperidin-1-ylmethyl)pentanoate |
|---|---|
| PubChem CID | 117242052 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | methyl 4,4-dimethyl-2-(piperidin-1-ylmethyl)pentanoate |
| SMILES | COC(=O)C(CN1CCCCC1)CC(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-14(2,3)10-12(13(16)17-4)11-15-8-6-5-7-9-15/h12H,5-11H2,1-4H3 |
| InChIKey | LXOMVFDSEOOCMZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |