C18H32O4 — CID 101071266
dimethyl (2R,4S)-2-cyclohexyl-4-(2,2-dimethylpropyl)pentanedioate (PubChem CID 101071266) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is dimethyl (2R,4S)-2-cyclohexyl-4-(2,2-dimethylpropyl)pentanedioate.
| Compound Name | dimethyl (2R,4S)-2-cyclohexyl-4-(2,2-dimethylpropyl)pentanedioate |
|---|---|
| PubChem CID | 101071266 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | dimethyl (2R,4S)-2-cyclohexyl-4-(2,2-dimethylpropyl)pentanedioate |
| SMILES | COC(=O)[C@@H](C[C@@H](C(=O)OC)C1CCCCC1)CC(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-18(2,3)12-14(16(19)21-4)11-15(17(20)22-5)13-9-7-6-8-10-13/h13-15H,6-12H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | DCGPTOSVPYJANJ-LSDHHAIUSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |