C18H32N2O3 — CID 167561074
tert-butyl (2S,3R)-2-acetamido-3-(piperidin-1-ylmethyl)hex-5-enoate (PubChem CID 167561074) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-acetamido-3-(piperidin-1-ylmethyl)hex-5-enoate.
| Compound Name | tert-butyl (2S,3R)-2-acetamido-3-(piperidin-1-ylmethyl)hex-5-enoate |
|---|---|
| PubChem CID | 167561074 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl (2S,3R)-2-acetamido-3-(piperidin-1-ylmethyl)hex-5-enoate |
| SMILES | C=CC[C@H](CN1CCCCC1)[C@H](NC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O3/c1-6-10-15(13-20-11-8-7-9-12-20)16(19-14(2)21)17(22)23-18(3,4)5/h6,15-16H,1,7-13H2,2-5H3,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | OQUDGTDMGCXFEP-CVEARBPZSA-N |
| XLogP | 2.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|