C20H27NO8 — CID 122436274
4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-3-(4-methylidenepiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122436274) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-3-(4-methylidenepiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-3-(4-methylidenepiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436274 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-3-(4-methylidenepiperidin-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | C=C1CCN(CC(COC(=O)/C=C/C(=O)OC)COC(=O)/C=C/C(=O)OC)CC1 |
| InChI | InChI=1S/C20H27NO8/c1-15-8-10-21(11-9-15)12-16(13-28-19(24)6-4-17(22)26-2)14-29-20(25)7-5-18(23)27-3/h4-7,16H,1,8-14H2,2-3H3/b6-4+,7-5+ |
| InChIKey | NCIDXXAGMNGKPY-YDFGWWAZSA-N |
| XLogP | 0.80 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|