C17H21NO10 — CID 122436484
4-O-[3-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-2-(2-oxomorpholin-4-yl)propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122436484) has the molecular formula C17H21NO10 and a molecular weight of 399.35 g/mol. Its IUPAC name is 4-O-[3-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-2-(2-oxomorpholin-4-yl)propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-2-(2-oxomorpholin-4-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436484 |
| Molecular Formula | C17H21NO10 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-O-[3-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-2-(2-oxomorpholin-4-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(COC(=O)/C=C/C(=O)OC)N1CCOC(=O)C1 |
| InChI | InChI=1S/C17H21NO10/c1-24-13(19)3-5-15(21)27-10-12(18-7-8-26-17(23)9-18)11-28-16(22)6-4-14(20)25-2/h3-6,12H,7-11H2,1-2H3/b5-3+,6-4+ |
| InChIKey | HZZHZNCIRNFRIT-GGWOSOGESA-N |
| XLogP | -1.24 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|