C12H19NO6 — CID 122664244
4-O-[(2R)-3-(diethylamino)-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122664244) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-O-[(2R)-3-(diethylamino)-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2R)-3-(diethylamino)-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122664244 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-O-[(2R)-3-(diethylamino)-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CCN(CC)C(=O)[C@H](O)COC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C12H19NO6/c1-4-13(5-2)12(17)9(14)8-19-11(16)7-6-10(15)18-3/h6-7,9,14H,4-5,8H2,1-3H3/b7-6+/t9-/m1/s1 |
| InChIKey | PAKNYOHWZGSJES-XCODYQFDSA-N |
| XLogP | -0.51 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|