C13H21NO8 — CID 122664262
(E)-4-[3-[bis(2-methoxyethyl)amino]-2-hydroxy-3-oxopropoxy]-4-oxobut-2-enoic acid (PubChem CID 122664262) has the molecular formula C13H21NO8 and a molecular weight of 319.31 g/mol. Its IUPAC name is (E)-4-[3-[bis(2-methoxyethyl)amino]-2-hydroxy-3-oxopropoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[bis(2-methoxyethyl)amino]-2-hydroxy-3-oxopropoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 122664262 |
| Molecular Formula | C13H21NO8 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (E)-4-[3-[bis(2-methoxyethyl)amino]-2-hydroxy-3-oxopropoxy]-4-oxobut-2-enoic acid |
| SMILES | COCCN(CCOC)C(=O)C(O)COC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H21NO8/c1-20-7-5-14(6-8-21-2)13(19)10(15)9-22-12(18)4-3-11(16)17/h3-4,10,15H,5-9H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | OSMXTOYQKSXGPO-ONEGZZNKSA-N |
| XLogP | -1.35 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|