C16H17NO11 — CID 142491947
(E)-4-[bis[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 142491947) has the molecular formula C16H17NO11 and a molecular weight of 399.31 g/mol. Its IUPAC name is (E)-4-[bis[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[bis[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 142491947 |
| Molecular Formula | C16H17NO11 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (E)-4-[bis[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCCN(CCOC(=O)/C=C/C(=O)O)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H17NO11/c18-11(1-2-12(19)20)17(7-9-27-15(25)5-3-13(21)22)8-10-28-16(26)6-4-14(23)24/h1-6H,7-10H2,(H,19,20)(H,21,22)(H,23,24)/b2-1+,5-3+,6-4+ |
| InChIKey | GOTMQRKYTRFLPJ-CRQXNEITSA-N |
| XLogP | -1.18 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|