C14H27N3O3 — CID 76886080
4-[bis[3-(dimethylamino)propyl]amino]-4-oxobut-2-enoic acid (PubChem CID 76886080) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[bis[3-(dimethylamino)propyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[bis[3-(dimethylamino)propyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76886080 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 4-[bis[3-(dimethylamino)propyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)C=CC(=O)O |
| InChI | InChI=1S/C14H27N3O3/c1-15(2)9-5-11-17(12-6-10-16(3)4)13(18)7-8-14(19)20/h7-8H,5-6,9-12H2,1-4H3,(H,19,20) |
| InChIKey | UVUSSQKVLDMQCN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|