C15H32N4O2 — CID 141463715
N',N'-bis[3-(dimethylamino)propyl]pentanediamide (PubChem CID 141463715) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N',N'-bis[3-(dimethylamino)propyl]pentanediamide.
| Compound Name | N',N'-bis[3-(dimethylamino)propyl]pentanediamide |
|---|---|
| PubChem CID | 141463715 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | N',N'-bis[3-(dimethylamino)propyl]pentanediamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)CCCC(N)=O |
| InChI | InChI=1S/C15H32N4O2/c1-17(2)10-6-12-19(13-7-11-18(3)4)15(21)9-5-8-14(16)20/h5-13H2,1-4H3,(H2,16,20) |
| InChIKey | IBJGVNKZJSVVOH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |