C12H26ClN3O — CID 60809657
2-chloro-N,N-bis[3-(dimethylamino)propyl]acetamide (PubChem CID 60809657) has the molecular formula C12H26ClN3O and a molecular weight of 263.81 g/mol. Its IUPAC name is 2-chloro-N,N-bis[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-chloro-N,N-bis[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 60809657 |
| Molecular Formula | C12H26ClN3O |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 2-chloro-N,N-bis[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)CCl |
| InChI | InChI=1S/C12H26ClN3O/c1-14(2)7-5-9-16(12(17)11-13)10-6-8-15(3)4/h5-11H2,1-4H3 |
| InChIKey | YRIAYKDAJYKMDW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|