C11H12N2O6 — CID 122664290
4-O-(2-hydroxy-3-oxo-3-pyrazol-1-ylpropyl) 1-O-methyl (E)-but-2-enedioate (PubChem CID 122664290) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 4-O-(2-hydroxy-3-oxo-3-pyrazol-1-ylpropyl) 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-(2-hydroxy-3-oxo-3-pyrazol-1-ylpropyl) 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122664290 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-O-(2-hydroxy-3-oxo-3-pyrazol-1-ylpropyl) 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(O)C(=O)n1cccn1 |
| InChI | InChI=1S/C11H12N2O6/c1-18-9(15)3-4-10(16)19-7-8(14)11(17)13-6-2-5-12-13/h2-6,8,14H,7H2,1H3/b4-3+ |
| InChIKey | RTWFKRTVDWABIK-ONEGZZNKSA-N |
| XLogP | -0.84 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|