C18H22N2O8 — CID 122436278
4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-4-pyrazol-1-ylbutyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122436278) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-4-pyrazol-1-ylbutyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-4-pyrazol-1-ylbutyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122436278 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-O-[2-[[(E)-4-methoxy-4-oxobut-2-enoyl]oxymethyl]-4-pyrazol-1-ylbutyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(CCn1cccn1)COC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C18H22N2O8/c1-25-15(21)4-6-17(23)27-12-14(8-11-20-10-3-9-19-20)13-28-18(24)7-5-16(22)26-2/h3-7,9-10,14H,8,11-13H2,1-2H3/b6-4+,7-5+ |
| InChIKey | FUXLFCSLWXZJHA-YDFGWWAZSA-N |
| XLogP | 0.43 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|