C8H14N2O2 — CID 134462752
(2S)-1-methoxy-4-pyrazol-1-ylbutan-2-ol (PubChem CID 134462752) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2S)-1-methoxy-4-pyrazol-1-ylbutan-2-ol.
| Compound Name | (2S)-1-methoxy-4-pyrazol-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 134462752 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2S)-1-methoxy-4-pyrazol-1-ylbutan-2-ol |
| SMILES | COC[C@@H](O)CCn1cccn1 |
| InChI | InChI=1S/C8H14N2O2/c1-12-7-8(11)3-6-10-5-2-4-9-10/h2,4-5,8,11H,3,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | OZLDZJATMUKQQS-QMMMGPOBSA-N |
| XLogP | 0.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |