C13H19NO4 — CID 122487325
4-O-[(1-ethyl-5-methylidenepyrrolidin-2-yl)methyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122487325) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-O-[(1-ethyl-5-methylidenepyrrolidin-2-yl)methyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(1-ethyl-5-methylidenepyrrolidin-2-yl)methyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122487325 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-O-[(1-ethyl-5-methylidenepyrrolidin-2-yl)methyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | C=C1CCC(COC(=O)/C=C/C(=O)OC)N1CC |
| InChI | InChI=1S/C13H19NO4/c1-4-14-10(2)5-6-11(14)9-18-13(16)8-7-12(15)17-3/h7-8,11H,2,4-6,9H2,1,3H3/b8-7+ |
| InChIKey | FAQWOEQWBYROQY-BQYQJAHWSA-N |
| XLogP | 1.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|